C10H16Cl3NO4 — CID 121215678
tert-butyl (2S,3S)-3-hydroxy-2-[(2,2,2-trichloroacetyl)amino]butanoate (PubChem CID 121215678) has the molecular formula C10H16Cl3NO4 and a molecular weight of 320.60 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-hydroxy-2-[(2,2,2-trichloroacetyl)amino]butanoate.
| Compound Name | tert-butyl (2S,3S)-3-hydroxy-2-[(2,2,2-trichloroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 121215678 |
| Molecular Formula | C10H16Cl3NO4 |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | tert-butyl (2S,3S)-3-hydroxy-2-[(2,2,2-trichloroacetyl)amino]butanoate |
| SMILES | C[C@H](O)[C@H](NC(=O)C(Cl)(Cl)Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H16Cl3NO4/c1-5(15)6(7(16)18-9(2,3)4)14-8(17)10(11,12)13/h5-6,15H,1-4H3,(H,14,17)/t5-,6-/m0/s1 |
| InChIKey | FXTVZXPEJCABEA-WDSKDSINSA-N |
| XLogP | 1.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|