C10H18N2O5 — CID 130405478
tert-butyl N-[(3S,4R)-1-amino-4-hydroxy-1,2-dioxopentan-3-yl]carbamate (PubChem CID 130405478) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-1-amino-4-hydroxy-1,2-dioxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-1-amino-4-hydroxy-1,2-dioxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 130405478 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | tert-butyl N-[(3S,4R)-1-amino-4-hydroxy-1,2-dioxopentan-3-yl]carbamate |
| SMILES | C[C@@H](O)[C@H](NC(=O)OC(C)(C)C)C(=O)C(N)=O |
| InChI | InChI=1S/C10H18N2O5/c1-5(13)6(7(14)8(11)15)12-9(16)17-10(2,3)4/h5-6,13H,1-4H3,(H2,11,15)(H,12,16)/t5-,6+/m1/s1 |
| InChIKey | BMHFDZZZKHTCGI-RITPCOANSA-N |
| XLogP | -0.69 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|