C10H19N2NaO8S — CID 140666148
sodium [[(2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxymethanesulfonate (PubChem CID 140666148) has the molecular formula C10H19N2NaO8S and a molecular weight of 350.33 g/mol. Its IUPAC name is sodium [[(2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxymethanesulfonate.
| Compound Name | sodium [[(2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxymethanesulfonate |
|---|---|
| PubChem CID | 140666148 |
| Molecular Formula | C10H19N2NaO8S |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | sodium [[(2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]oxymethanesulfonate |
| SMILES | C[C@@H](O)[C@H](NC(=O)OC(C)(C)C)C(=O)NOCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H20N2O8S.Na/c1-6(13)7(11-9(15)20-10(2,3)4)8(14)12-19-5-21(16,17)18;/h6-7,13H,5H2,1-4H3,(H,11,15)(H,12,14)(H,16,17,18);/q;+1/p-1/t6-,7+;/m1./s1 |
| InChIKey | JIGSLVQGLCBEKU-HHQFNNIRSA-M |
| XLogP | -4.18 |
| TPSA | 154.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|