C14H27BN2O4 — CID 58695064
CID 58695064 (PubChem CID 58695064) has the molecular formula C14H27BN2O4 and a molecular weight of 298.19 g/mol.
| Compound Name | CID 58695064 |
|---|---|
| PubChem CID | 58695064 |
| Molecular Formula | C14H27BN2O4 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | — |
| SMILES | [B][C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C14H27BN2O4/c1-8(2)7-10(15)16-12(19)11(9(3)18)17-13(20)21-14(4,5)6/h8-11,18H,7H2,1-6H3,(H,16,19)(H,17,20)/t9-,10+,11+/m1/s1 |
| InChIKey | XTSZFLUMBOKUCE-VWYCJHECSA-N |
| XLogP | 0.92 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|