C10H21NO4P+ — CID 87772766
hydroxy-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxophosphanium (PubChem CID 87772766) has the molecular formula C10H21NO4P+ and a molecular weight of 250.25 g/mol. Its IUPAC name is hydroxy-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxophosphanium.
| Compound Name | hydroxy-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxophosphanium |
|---|---|
| PubChem CID | 87772766 |
| Molecular Formula | C10H21NO4P+ |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | hydroxy-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxophosphanium |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)[P+](=O)O |
| InChI | InChI=1S/C10H20NO4P/c1-7(2)6-8(16(13)14)11-9(12)15-10(3,4)5/h7-8H,6H2,1-5H3,(H-,11,12,13,14)/p+1 |
| InChIKey | IARILRNZIXRAPM-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|