C14H29N3O3 — CID 139190271
tert-butyl N-[(1R)-3-methyl-1-(propan-2-ylcarbamoylamino)butyl]carbamate (PubChem CID 139190271) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-methyl-1-(propan-2-ylcarbamoylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-methyl-1-(propan-2-ylcarbamoylamino)butyl]carbamate |
|---|---|
| PubChem CID | 139190271 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | tert-butyl N-[(1R)-3-methyl-1-(propan-2-ylcarbamoylamino)butyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)NC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29N3O3/c1-9(2)8-11(16-12(18)15-10(3)4)17-13(19)20-14(5,6)7/h9-11H,8H2,1-7H3,(H,17,19)(H2,15,16,18)/t11-/m1/s1 |
| InChIKey | SHDNVLIBNYXWLH-LLVKDONJSA-N |
| XLogP | 2.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|