C17H27N3O3 — CID 177483489
tert-butyl N-[(1S)-2-phenyl-1-(propan-2-ylcarbamoylamino)ethyl]carbamate (PubChem CID 177483489) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-phenyl-1-(propan-2-ylcarbamoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-phenyl-1-(propan-2-ylcarbamoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 177483489 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl N-[(1S)-2-phenyl-1-(propan-2-ylcarbamoylamino)ethyl]carbamate |
| SMILES | CC(C)NC(=O)N[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-12(2)18-15(21)19-14(11-13-9-7-6-8-10-13)20-16(22)23-17(3,4)5/h6-10,12,14H,11H2,1-5H3,(H,20,22)(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | LDBGOUXPFYLRRL-AWEZNQCLSA-N |
| XLogP | 2.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|