C20H31N3O5 — CID 16680416
methyl (2S)-3-methyl-2-[[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]carbamoylamino]butanoate (PubChem CID 16680416) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]carbamoylamino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 16680416 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]carbamoylamino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H31N3O5/c1-13(2)16(17(24)27-6)23-18(25)21-15(12-14-10-8-7-9-11-14)22-19(26)28-20(3,4)5/h7-11,13,15-16H,12H2,1-6H3,(H,22,26)(H2,21,23,25)/t15-,16-/m0/s1 |
| InChIKey | WLAZKOMYRLVJFP-HOTGVXAUSA-N |
| XLogP | 2.58 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|