C14H28N2O5S — CID 110612488
tert-butyl N-[3-methyl-1-(2-methylsulfonylethylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 110612488) has the molecular formula C14H28N2O5S and a molecular weight of 336.45 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-(2-methylsulfonylethylamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-(2-methylsulfonylethylamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 110612488 |
| Molecular Formula | C14H28N2O5S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | tert-butyl N-[3-methyl-1-(2-methylsulfonylethylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(C)C(NC(=O)OC(C)(C)C)C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C14H28N2O5S/c1-7-10(2)11(16-13(18)21-14(3,4)5)12(17)15-8-9-22(6,19)20/h10-11H,7-9H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | SEQUQFQCVWSWHQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |