C14H27NO4S — CID 163716842
tert-butyl N-[(3S)-1-[dimethyl(oxo)-λ6-sulfanylidene]-4-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 163716842) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[dimethyl(oxo)-λ6-sulfanylidene]-4-methyl-2-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[dimethyl(oxo)-λ6-sulfanylidene]-4-methyl-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 163716842 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | tert-butyl N-[(3S)-1-[dimethyl(oxo)-λ6-sulfanylidene]-4-methyl-2-oxohexan-3-yl]carbamate |
| SMILES | CCC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)C=S(C)(C)=O |
| InChI | InChI=1S/C14H27NO4S/c1-8-10(2)12(11(16)9-20(6,7)18)15-13(17)19-14(3,4)5/h9-10,12H,8H2,1-7H3,(H,15,17)/t10?,12-/m0/s1 |
| InChIKey | KOCLSYHLMONKLD-KFJBMODSSA-N |
| XLogP | 1.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|