C6H8F3N3O4 — CID 90425869
[1-oxo-1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]propan-2-yl]carbamic acid (PubChem CID 90425869) has the molecular formula C6H8F3N3O4 and a molecular weight of 243.14 g/mol. Its IUPAC name is [1-oxo-1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]propan-2-yl]carbamic acid.
| Compound Name | [1-oxo-1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90425869 |
| Molecular Formula | C6H8F3N3O4 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | [1-oxo-1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]propan-2-yl]carbamic acid |
| SMILES | CC(NC(=O)O)C(=O)NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3O4/c1-2(10-5(15)16)3(13)11-12-4(14)6(7,8)9/h2,10H,1H3,(H,11,13)(H,12,14)(H,15,16) |
| InChIKey | SZJUCQLGLLGTJU-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|