C6H10F3N3O2S — CID 88662586
1-propan-2-ylsulfanyl-3-[(2,2,2-trifluoroacetyl)amino]urea (PubChem CID 88662586) has the molecular formula C6H10F3N3O2S and a molecular weight of 245.23 g/mol. Its IUPAC name is 1-propan-2-ylsulfanyl-3-[(2,2,2-trifluoroacetyl)amino]urea.
| Compound Name | 1-propan-2-ylsulfanyl-3-[(2,2,2-trifluoroacetyl)amino]urea |
|---|---|
| PubChem CID | 88662586 |
| Molecular Formula | C6H10F3N3O2S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-propan-2-ylsulfanyl-3-[(2,2,2-trifluoroacetyl)amino]urea |
| SMILES | CC(C)SNC(=O)NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3N3O2S/c1-3(2)15-12-5(14)11-10-4(13)6(7,8)9/h3H,1-2H3,(H,10,13)(H2,11,12,14) |
| InChIKey | RZIJBLDGTQFHAF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|