C7H11F3N2O2 — CID 163138483
N-[[(2R)-butan-2-yl]carbamoyl]-2,2,2-trifluoroacetamide (PubChem CID 163138483) has the molecular formula C7H11F3N2O2 and a molecular weight of 212.17 g/mol. Its IUPAC name is N-[[(2R)-butan-2-yl]carbamoyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[(2R)-butan-2-yl]carbamoyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 163138483 |
| Molecular Formula | C7H11F3N2O2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-[[(2R)-butan-2-yl]carbamoyl]-2,2,2-trifluoroacetamide |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2/c1-3-4(2)11-6(14)12-5(13)7(8,9)10/h4H,3H2,1-2H3,(H2,11,12,13,14)/t4-/m1/s1 |
| InChIKey | IWPALOPKPIXBHU-SCSAIBSYSA-N |
| XLogP | 1.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |