C12H15F2NO — CID 164554338
N-butan-2-yl-2,2-difluoro-2-phenylacetamide (PubChem CID 164554338) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is N-butan-2-yl-2,2-difluoro-2-phenylacetamide.
| Compound Name | N-butan-2-yl-2,2-difluoro-2-phenylacetamide |
|---|---|
| PubChem CID | 164554338 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-butan-2-yl-2,2-difluoro-2-phenylacetamide |
| SMILES | CCC(C)NC(=O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C12H15F2NO/c1-3-9(2)15-11(16)12(13,14)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,15,16) |
| InChIKey | IZRRHGSABVRPPB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |