C8H10BrF6NO — CID 163140442
2-bromo-N-[(2R)-butan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 163140442) has the molecular formula C8H10BrF6NO and a molecular weight of 330.07 g/mol. Its IUPAC name is 2-bromo-N-[(2R)-butan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | 2-bromo-N-[(2R)-butan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 163140442 |
| Molecular Formula | C8H10BrF6NO |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-bromo-N-[(2R)-butan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CC[C@@H](C)NC(=O)C(Br)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10BrF6NO/c1-3-4(2)16-5(17)6(9,7(10,11)12)8(13,14)15/h4H,3H2,1-2H3,(H,16,17)/t4-/m1/s1 |
| InChIKey | JOUQNOGCASWRSP-SCSAIBSYSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|