C9H17F3N2O — CID 79790165
2-amino-3,3,3-trifluoro-2-methyl-N-pentan-2-ylpropanamide (PubChem CID 79790165) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-methyl-N-pentan-2-ylpropanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-2-methyl-N-pentan-2-ylpropanamide |
|---|---|
| PubChem CID | 79790165 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-methyl-N-pentan-2-ylpropanamide |
| SMILES | CCCC(C)NC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O/c1-4-5-6(2)14-7(15)8(3,13)9(10,11)12/h6H,4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | PCFHTYNLNBYEPW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |