C8H12F6N2O — CID 2276888
1-[(2R)-butan-2-yl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea (PubChem CID 2276888) has the molecular formula C8H12F6N2O and a molecular weight of 266.19 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
|---|---|
| PubChem CID | 2276888 |
| Molecular Formula | C8H12F6N2O |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
| SMILES | CC[C@@H](C)NC(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6N2O/c1-3-4(2)15-6(17)16-5(7(9,10)11)8(12,13)14/h4-5H,3H2,1-2H3,(H2,15,16,17)/t4-/m1/s1 |
| InChIKey | JJMIZFIRKGFFBT-SCSAIBSYSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |