C9H18N2O4 — CID 104965693
(2S,3R)-2-(butan-2-ylcarbamoylamino)-3-hydroxybutanoic acid (PubChem CID 104965693) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2S,3R)-2-(butan-2-ylcarbamoylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(butan-2-ylcarbamoylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104965693 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2S,3R)-2-(butan-2-ylcarbamoylamino)-3-hydroxybutanoic acid |
| SMILES | CCC(C)NC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C9H18N2O4/c1-4-5(2)10-9(15)11-7(6(3)12)8(13)14/h5-7,12H,4H2,1-3H3,(H,13,14)(H2,10,11,15)/t5?,6-,7+/m1/s1 |
| InChIKey | KAUHWAYMSXFSOC-FWPZAIACSA-N |
| XLogP | -0.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |