C10H18N2O4 — CID 104966582
(2S,3R)-3-hydroxy-2-(pent-4-en-2-ylcarbamoylamino)butanoic acid (PubChem CID 104966582) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(pent-4-en-2-ylcarbamoylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(pent-4-en-2-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 104966582 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(pent-4-en-2-ylcarbamoylamino)butanoic acid |
| SMILES | C=CCC(C)NC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C10H18N2O4/c1-4-5-6(2)11-10(16)12-8(7(3)13)9(14)15/h4,6-8,13H,1,5H2,2-3H3,(H,14,15)(H2,11,12,16)/t6?,7-,8+/m1/s1 |
| InChIKey | HWBKFRPEACNPCX-VVXQKDJTSA-N |
| XLogP | 0.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|