C7H12F2N2O4 — CID 104966469
(2S,3R)-2-(2,2-difluoroethylcarbamoylamino)-3-hydroxybutanoic acid (PubChem CID 104966469) has the molecular formula C7H12F2N2O4 and a molecular weight of 226.18 g/mol. Its IUPAC name is (2S,3R)-2-(2,2-difluoroethylcarbamoylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(2,2-difluoroethylcarbamoylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104966469 |
| Molecular Formula | C7H12F2N2O4 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (2S,3R)-2-(2,2-difluoroethylcarbamoylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)NCC(F)F)C(=O)O |
| InChI | InChI=1S/C7H12F2N2O4/c1-3(12)5(6(13)14)11-7(15)10-2-4(8)9/h3-5,12H,2H2,1H3,(H,13,14)(H2,10,11,15)/t3-,5+/m1/s1 |
| InChIKey | XSHJHKGKNDMGBA-WUJLRWPWSA-N |
| XLogP | -0.62 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |