C8H14F2N2O3 — CID 115408104
2-(2,2-difluoroethylcarbamoylamino)-3-methylbutanoic acid (PubChem CID 115408104) has the molecular formula C8H14F2N2O3 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-(2,2-difluoroethylcarbamoylamino)-3-methylbutanoic acid.
| Compound Name | 2-(2,2-difluoroethylcarbamoylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 115408104 |
| Molecular Formula | C8H14F2N2O3 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-(2,2-difluoroethylcarbamoylamino)-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)NCC(F)F)C(=O)O |
| InChI | InChI=1S/C8H14F2N2O3/c1-4(2)6(7(13)14)12-8(15)11-3-5(9)10/h4-6H,3H2,1-2H3,(H,13,14)(H2,11,12,15) |
| InChIKey | XGTLZINPRWSWHZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |