C9H16N2O3 — CID 3947242
3-methyl-2-(prop-2-enylcarbamoylamino)butanoic acid (PubChem CID 3947242) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-methyl-2-(prop-2-enylcarbamoylamino)butanoic acid.
| Compound Name | 3-methyl-2-(prop-2-enylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 3947242 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-methyl-2-(prop-2-enylcarbamoylamino)butanoic acid |
| SMILES | C=CCNC(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C9H16N2O3/c1-4-5-10-9(14)11-7(6(2)3)8(12)13/h4,6-7H,1,5H2,2-3H3,(H,12,13)(H2,10,11,14) |
| InChIKey | KMURLFZNLYEABQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|