C6H12F2N2O — CID 87414397
1-(2,2-difluoroethyl)-3-propan-2-ylurea (PubChem CID 87414397) has the molecular formula C6H12F2N2O and a molecular weight of 166.17 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-propan-2-ylurea.
| Compound Name | 1-(2,2-difluoroethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 87414397 |
| Molecular Formula | C6H12F2N2O |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCC(F)F |
| InChI | InChI=1S/C6H12F2N2O/c1-4(2)10-6(11)9-3-5(7)8/h4-5H,3H2,1-2H3,(H2,9,10,11) |
| InChIKey | AMBMOMKDCWZXPT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |