C6H8F2N2O — CID 126992022
1-(2,2-difluoroethyl)-3-prop-2-ynylurea (PubChem CID 126992022) has the molecular formula C6H8F2N2O and a molecular weight of 162.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-prop-2-ynylurea.
| Compound Name | 1-(2,2-difluoroethyl)-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 126992022 |
| Molecular Formula | C6H8F2N2O |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)NCC(F)F |
| InChI | InChI=1S/C6H8F2N2O/c1-2-3-9-6(11)10-4-5(7)8/h1,5H,3-4H2,(H2,9,10,11) |
| InChIKey | DUQZFUSZPJBMON-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|