C6H11ClF2N2O — CID 131224415
1-(2,2-difluoroethyl)-3-prop-2-enylurea;hydrochloride (PubChem CID 131224415) has the molecular formula C6H11ClF2N2O and a molecular weight of 200.62 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-prop-2-enylurea;hydrochloride.
| Compound Name | 1-(2,2-difluoroethyl)-3-prop-2-enylurea;hydrochloride |
|---|---|
| PubChem CID | 131224415 |
| Molecular Formula | C6H11ClF2N2O |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-prop-2-enylurea;hydrochloride |
| SMILES | C=CCNC(=O)NCC(F)F.Cl |
| InChI | InChI=1S/C6H10F2N2O.ClH/c1-2-3-9-6(11)10-4-5(7)8;/h2,5H,1,3-4H2,(H2,9,10,11);1H |
| InChIKey | CAJZYUVCTFLVBX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|