C5H8N2O2 — CID 87901285
N-(prop-2-enylcarbamoyl)formamide (PubChem CID 87901285) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is N-(prop-2-enylcarbamoyl)formamide.
| Compound Name | N-(prop-2-enylcarbamoyl)formamide |
|---|---|
| PubChem CID | 87901285 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | N-(prop-2-enylcarbamoyl)formamide |
| SMILES | C=CCNC(=O)NC=O |
| InChI | InChI=1S/C5H8N2O2/c1-2-3-6-5(9)7-4-8/h2,4H,1,3H2,(H2,6,7,8,9) |
| InChIKey | CEUORGSQIOWPLB-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|