C7H12N4O3 — CID 36507216
2-(prop-2-enylcarbamoylamino)propanediamide (PubChem CID 36507216) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-(prop-2-enylcarbamoylamino)propanediamide.
| Compound Name | 2-(prop-2-enylcarbamoylamino)propanediamide |
|---|---|
| PubChem CID | 36507216 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-(prop-2-enylcarbamoylamino)propanediamide |
| SMILES | C=CCNC(=O)NC(C(N)=O)C(N)=O |
| InChI | InChI=1S/C7H12N4O3/c1-2-3-10-7(14)11-4(5(8)12)6(9)13/h2,4H,1,3H2,(H2,8,12)(H2,9,13)(H2,10,11,14) |
| InChIKey | OVOCJYTZLUWBMN-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|