C14H17N3O4 — CID 70609159
benzyl N-[1-amino-1,3-dioxo-3-(prop-2-enylamino)propan-2-yl]carbamate (PubChem CID 70609159) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is benzyl N-[1-amino-1,3-dioxo-3-(prop-2-enylamino)propan-2-yl]carbamate.
| Compound Name | benzyl N-[1-amino-1,3-dioxo-3-(prop-2-enylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 70609159 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | benzyl N-[1-amino-1,3-dioxo-3-(prop-2-enylamino)propan-2-yl]carbamate |
| SMILES | C=CCNC(=O)C(NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C14H17N3O4/c1-2-8-16-13(19)11(12(15)18)17-14(20)21-9-10-6-4-3-5-7-10/h2-7,11H,1,8-9H2,(H2,15,18)(H,16,19)(H,17,20) |
| InChIKey | KQPGUATZUVGYHJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|