C25H30N2O3 — CID 102151861
benzyl N-[(2S,3S)-3-methyl-1-phenyl-3-(prop-2-enylcarbamoyl)hex-5-en-2-yl]carbamate (PubChem CID 102151861) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-3-methyl-1-phenyl-3-(prop-2-enylcarbamoyl)hex-5-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-3-methyl-1-phenyl-3-(prop-2-enylcarbamoyl)hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 102151861 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | benzyl N-[(2S,3S)-3-methyl-1-phenyl-3-(prop-2-enylcarbamoyl)hex-5-en-2-yl]carbamate |
| SMILES | C=CCNC(=O)[C@@](C)(CC=C)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H30N2O3/c1-4-16-25(3,23(28)26-17-5-2)22(18-20-12-8-6-9-13-20)27-24(29)30-19-21-14-10-7-11-15-21/h4-15,22H,1-2,16-19H2,3H3,(H,26,28)(H,27,29)/t22-,25-/m0/s1 |
| InChIKey | NRNVQAQRVVKSRZ-DHLKQENFSA-N |
| XLogP | 4.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|