C8H17N2O+ — CID 174433469
hydron;1-(2-methylpropyl)-3-prop-2-enylurea (PubChem CID 174433469) has the molecular formula C8H17N2O+ and a molecular weight of 157.24 g/mol. Its IUPAC name is hydron;1-(2-methylpropyl)-3-prop-2-enylurea.
| Compound Name | hydron;1-(2-methylpropyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 174433469 |
| Molecular Formula | C8H17N2O+ |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | hydron;1-(2-methylpropyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NCC(C)C.[H+] |
| InChI | InChI=1S/C8H16N2O/c1-4-5-9-8(11)10-6-7(2)3/h4,7H,1,5-6H2,2-3H3,(H2,9,10,11)/p+1 |
| InChIKey | QEWHEEPNRMOMLV-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|