C7H14N2O2 — CID 117235660
1-(2-methylpropyl)-3-(2-oxoethyl)urea (PubChem CID 117235660) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(2-oxoethyl)urea.
| Compound Name | 1-(2-methylpropyl)-3-(2-oxoethyl)urea |
|---|---|
| PubChem CID | 117235660 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1-(2-methylpropyl)-3-(2-oxoethyl)urea |
| SMILES | CC(C)CNC(=O)NCC=O |
| InChI | InChI=1S/C7H14N2O2/c1-6(2)5-9-7(11)8-3-4-10/h4,6H,3,5H2,1-2H3,(H2,8,9,11) |
| InChIKey | QYVAVOXPCSYKPX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|