C12H22N2O2S — CID 155458254
S-(3-methylbutyl) 3-(prop-2-enylcarbamoylamino)propanethioate (PubChem CID 155458254) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is S-(3-methylbutyl) 3-(prop-2-enylcarbamoylamino)propanethioate.
| Compound Name | S-(3-methylbutyl) 3-(prop-2-enylcarbamoylamino)propanethioate |
|---|---|
| PubChem CID | 155458254 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | S-(3-methylbutyl) 3-(prop-2-enylcarbamoylamino)propanethioate |
| SMILES | C=CCNC(=O)NCCC(=O)SCCC(C)C |
| InChI | InChI=1S/C12H22N2O2S/c1-4-7-13-12(16)14-8-5-11(15)17-9-6-10(2)3/h4,10H,1,5-9H2,2-3H3,(H2,13,14,16) |
| InChIKey | RIWXOQPBWNBAJV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|