C19H30N2O6S — CID 166753760
S-[2-[[(E)-5-prop-2-enoxyhex-2-enoxy]carbonylamino]ethyl] 3-(prop-2-enoxycarbonylamino)propanethioate (PubChem CID 166753760) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is S-[2-[[(E)-5-prop-2-enoxyhex-2-enoxy]carbonylamino]ethyl] 3-(prop-2-enoxycarbonylamino)propanethioate.
| Compound Name | S-[2-[[(E)-5-prop-2-enoxyhex-2-enoxy]carbonylamino]ethyl] 3-(prop-2-enoxycarbonylamino)propanethioate |
|---|---|
| PubChem CID | 166753760 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | S-[2-[[(E)-5-prop-2-enoxyhex-2-enoxy]carbonylamino]ethyl] 3-(prop-2-enoxycarbonylamino)propanethioate |
| SMILES | C=CCOC(=O)NCCC(=O)SCCNC(=O)OC/C=C/CC(C)OCC=C |
| InChI | InChI=1S/C19H30N2O6S/c1-4-12-25-16(3)8-6-7-14-27-19(24)21-11-15-28-17(22)9-10-20-18(23)26-13-5-2/h4-7,16H,1-2,8-15H2,3H3,(H,20,23)(H,21,24)/b7-6+ |
| InChIKey | PLWTYKVTRCKNMO-VOTSOKGWSA-N |
| XLogP | 2.81 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|