About prop-2-enylcarbamoyl formate
prop-2-enylcarbamoyl formate (PubChem CID 173333387) has the molecular formula C5H7NO3
and a molecular weight of 129.12 g/mol. Its IUPAC name is prop-2-enylcarbamoyl formate.
Molecular Properties
| Compound Name | prop-2-enylcarbamoyl formate |
| PubChem CID | 173333387 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | prop-2-enylcarbamoyl formate |
| SMILES | C=CCNC(=O)OC=O |
| InChI | InChI=1S/C5H7NO3/c1-2-3-6-5(8)9-4-7/h2,4H,1,3H2,(H,6,8) |
| InChIKey | JQTYGFNMMATRSV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enylcarbamoyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enylcarbamoyl formate?
The IUPAC name of prop-2-enylcarbamoyl formate (CID 173333387) is prop-2-enylcarbamoyl formate.
What is the SMILES notation for prop-2-enylcarbamoyl formate?
The canonical SMILES for prop-2-enylcarbamoyl formate is C=CCNC(=O)OC=O.
What is the InChIKey of prop-2-enylcarbamoyl formate?
The InChIKey is JQTYGFNMMATRSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c1-2-3-6-5(8)9-4-7/h2,4H,1,3H2,(H,6,8).
What are the key properties of prop-2-enylcarbamoyl formate?
prop-2-enylcarbamoyl formate has a molecular weight of 129.12 g/mol, XLogP of 0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enylcarbamoyl formate is sourced from PubChem (CID 173333387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).