About methanethiol;prop-2-enylcarbamic acid
methanethiol;prop-2-enylcarbamic acid (PubChem CID 175464551) has the molecular formula C5H11NO2S
and a molecular weight of 149.21 g/mol. Its IUPAC name is methanethiol;prop-2-enylcarbamic acid.
Molecular Properties
| Compound Name | methanethiol;prop-2-enylcarbamic acid |
| PubChem CID | 175464551 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | methanethiol;prop-2-enylcarbamic acid |
| SMILES | C=CCNC(=O)O.CS |
| InChI | InChI=1S/C4H7NO2.CH4S/c1-2-3-5-4(6)7;1-2/h2,5H,1,3H2,(H,6,7);2H,1H3 |
| InChIKey | WYQOHWMQZRBALR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;prop-2-enylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;prop-2-enylcarbamic acid?
The IUPAC name of methanethiol;prop-2-enylcarbamic acid (CID 175464551) is methanethiol;prop-2-enylcarbamic acid.
What is the SMILES notation for methanethiol;prop-2-enylcarbamic acid?
The canonical SMILES for methanethiol;prop-2-enylcarbamic acid is C=CCNC(=O)O.CS.
What is the InChIKey of methanethiol;prop-2-enylcarbamic acid?
The InChIKey is WYQOHWMQZRBALR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.CH4S/c1-2-3-5-4(6)7;1-2/h2,5H,1,3H2,(H,6,7);2H,1H3.
What are the key properties of methanethiol;prop-2-enylcarbamic acid?
methanethiol;prop-2-enylcarbamic acid has a molecular weight of 149.21 g/mol, XLogP of 0.99, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;prop-2-enylcarbamic acid is sourced from PubChem (CID 175464551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).