C17H28N2O5 — CID 175928809
bis(prop-2-enylcarbamic acid);3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 175928809) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is bis(prop-2-enylcarbamic acid);3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | bis(prop-2-enylcarbamic acid);3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 175928809 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | bis(prop-2-enylcarbamic acid);3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | C=CCNC(=O)O.C=CCNC(=O)O.CC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C9H14O.2C4H7NO2/c1-7-4-8(10)6-9(2,3)5-7;2*1-2-3-5-4(6)7/h4H,5-6H2,1-3H3;2*2,5H,1,3H2,(H,6,7) |
| InChIKey | ZJSXASCRHHHZQE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|