C14H22O4 — CID 158674312
2-hydroxyethyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 158674312) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | 2-hydroxyethyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 158674312 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | C=CC(=O)OCCO.CC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C9H14O.C5H8O3/c1-7-4-8(10)6-9(2,3)5-7;1-2-5(7)8-4-3-6/h4H,5-6H2,1-3H3;2,6H,1,3-4H2 |
| InChIKey | IEIDFIRZLHUSRU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|