C9H14CuO — CID 159197874
copper;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 159197874) has the molecular formula C9H14CuO and a molecular weight of 201.76 g/mol. Its IUPAC name is copper;3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | copper;3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 159197874 |
| Molecular Formula | C9H14CuO |
| Molecular Weight | 201.76 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | copper;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.[Cu] |
| InChI | InChI=1S/C9H14O.Cu/c1-7-4-8(10)6-9(2,3)5-7;/h4H,5-6H2,1-3H3; |
| InChIKey | KOWYJIHOSQLDQA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |