C9H15NaO2 — CID 70498993
sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide (PubChem CID 70498993) has the molecular formula C9H15NaO2 and a molecular weight of 178.21 g/mol. Its IUPAC name is sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide.
| Compound Name | sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide |
|---|---|
| PubChem CID | 70498993 |
| Molecular Formula | C9H15NaO2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide |
| SMILES | CC1=CC(=O)CC(C)(C)C1.[Na+].[OH-] |
| InChI | InChI=1S/C9H14O.Na.H2O/c1-7-4-8(10)6-9(2,3)5-7;;/h4H,5-6H2,1-3H3;;1H2/q;+1;/p-1 |
| InChIKey | FKOIRVAKGGFQJO-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 47.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |