About sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide
sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide (PubChem CID 70498993) has the molecular formula C9H15NaO2
and a molecular weight of 178.21 g/mol. Its IUPAC name is sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide.
Molecular Properties
| Compound Name | sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide |
| PubChem CID | 70498993 |
| Molecular Formula | C9H15NaO2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide |
| SMILES | CC1=CC(=O)CC(C)(C)C1.[Na+].[OH-] |
| InChI | InChI=1S/C9H14O.Na.H2O/c1-7-4-8(10)6-9(2,3)5-7;;/h4H,5-6H2,1-3H3;;1H2/q;+1;/p-1 |
| InChIKey | FKOIRVAKGGFQJO-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 47.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide?
The IUPAC name of sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide (CID 70498993) is sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide.
What is the SMILES notation for sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide?
The canonical SMILES for sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide is CC1=CC(=O)CC(C)(C)C1.[Na+].[OH-].
What is the InChIKey of sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide?
The InChIKey is FKOIRVAKGGFQJO-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14O.Na.H2O/c1-7-4-8(10)6-9(2,3)5-7;;/h4H,5-6H2,1-3H3;;1H2/q;+1;/p-1.
What are the key properties of sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide?
sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide has a molecular weight of 178.21 g/mol, XLogP of -0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3,5,5-trimethylcyclohex-2-en-1-one;hydroxide is sourced from PubChem (CID 70498993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).