C17H15F17O2 — CID 138619379
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-1-ol;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 138619379) has the molecular formula C17H15F17O2 and a molecular weight of 574.27 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-1-ol;3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-1-ol;3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 138619379 |
| Molecular Formula | C17H15F17O2 |
| Molecular Weight | 574.27 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-1-ol;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14O.C8HF17O/c1-7-4-8(10)6-9(2,3)5-7;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26/h4H,5-6H2,1-3H3;26H |
| InChIKey | JAFGQZQLOBAYDO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.27 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|