C17H20O5 — CID 158284461
benzene-1,3-dicarboxylic acid;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 158284461) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | benzene-1,3-dicarboxylic acid;3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 158284461 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H14O.C8H6O4/c1-7-4-8(10)6-9(2,3)5-7;9-7(10)5-2-1-3-6(4-5)8(11)12/h4H,5-6H2,1-3H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | GKPLAHUNKOVXJF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |