C15H30N4O3 — CID 126674135
bis(1,1-dimethylurea);3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 126674135) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is bis(1,1-dimethylurea);3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | bis(1,1-dimethylurea);3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 126674135 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | bis(1,1-dimethylurea);3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.CN(C)C(N)=O.CN(C)C(N)=O |
| InChI | InChI=1S/C9H14O.2C3H8N2O/c1-7-4-8(10)6-9(2,3)5-7;2*1-5(2)3(4)6/h4H,5-6H2,1-3H3;2*1-2H3,(H2,4,6) |
| InChIKey | YBGRLCCWAGOIMX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |