C13H20O3 — CID 174580204
methyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 174580204) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | methyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 174580204 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | methyl prop-2-enoate;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | C=CC(=O)OC.CC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C9H14O.C4H6O2/c1-7-4-8(10)6-9(2,3)5-7;1-3-4(5)6-2/h4H,5-6H2,1-3H3;3H,1H2,2H3 |
| InChIKey | NNXOEVZDIIBSHC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|