C12H18O2 — CID 123700194
methyl 2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetate (PubChem CID 123700194) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is methyl 2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetate.
| Compound Name | methyl 2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetate |
|---|---|
| PubChem CID | 123700194 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | methyl 2-(3,5,5-trimethylcyclohex-2-en-1-ylidene)acetate |
| SMILES | COC(=O)C=C1C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C12H18O2/c1-9-5-10(6-11(13)14-4)8-12(2,3)7-9/h5-6H,7-8H2,1-4H3 |
| InChIKey | AHIDAZKGOODVNE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|