C15H24O5 — CID 157499044
hexanedioic acid;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 157499044) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is hexanedioic acid;3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | hexanedioic acid;3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 157499044 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | hexanedioic acid;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C9H14O.C6H10O4/c1-7-4-8(10)6-9(2,3)5-7;7-5(8)3-1-2-4-6(9)10/h4H,5-6H2,1-3H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | BYEKTDCAHWPKMV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|