5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid

C13H20O3S — CID 117062433

IUPAC5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid
SMILESCC1(C)CC(=O)C=C(SCCCCC(=O)O)C1
InChIInChI=1S/C13H20O3S/c1-13(2)8-10(14)7-11(9-13)17-6-4-3-5-12(15)16/h7H,3-6,8-9H2,1-2H3,(H,15,16)
InChIKeyJYQQALBGGWCMJL-UHFFFAOYSA-N
MW256.37 g/mol
LogP3.25
Rot. Bonds6

About 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid

5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid (PubChem CID 117062433) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid.

Molecular Properties

Compound Name5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid
PubChem CID117062433
Molecular FormulaC13H20O3S
Molecular Weight256.37 g/mol
Exact Mass256.11
IUPAC Name5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid
SMILESCC1(C)CC(=O)C=C(SCCCCC(=O)O)C1
InChIInChI=1S/C13H20O3S/c1-13(2)8-10(14)7-11(9-13)17-6-4-3-5-12(15)16/h7H,3-6,8-9H2,1-2H3,(H,15,16)
InChIKeyJYQQALBGGWCMJL-UHFFFAOYSA-N
XLogP3.25
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.37
LogP ≤ 53.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid?
The IUPAC name of 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid (CID 117062433) is 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid.
What is the SMILES notation for 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid?
The canonical SMILES for 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid is CC1(C)CC(=O)C=C(SCCCCC(=O)O)C1.
What is the InChIKey of 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid?
The InChIKey is JYQQALBGGWCMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3S/c1-13(2)8-10(14)7-11(9-13)17-6-4-3-5-12(15)16/h7H,3-6,8-9H2,1-2H3,(H,15,16).
What are the key properties of 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid?
5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid has a molecular weight of 256.37 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,5-dimethyl-3-oxocyclohexen-1-yl)sulfanylpentanoic acid is sourced from PubChem (CID 117062433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).