C10H15NO3S — CID 106920818
6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexanoic acid (PubChem CID 106920818) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexanoic acid.
| Compound Name | 6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 106920818 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexanoic acid |
| SMILES | Cc1coc(SCCCCCC(=O)O)n1 |
| InChI | InChI=1S/C10H15NO3S/c1-8-7-14-10(11-8)15-6-4-2-3-5-9(12)13/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | SVQNBLGQAHIZQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|