C7H10ClNOS — CID 106920998
2-(3-chloropropylsulfanyl)-4-methyl-1,3-oxazole (PubChem CID 106920998) has the molecular formula C7H10ClNOS and a molecular weight of 191.68 g/mol. Its IUPAC name is 2-(3-chloropropylsulfanyl)-4-methyl-1,3-oxazole.
| Compound Name | 2-(3-chloropropylsulfanyl)-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 106920998 |
| Molecular Formula | C7H10ClNOS |
| Molecular Weight | 191.68 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 2-(3-chloropropylsulfanyl)-4-methyl-1,3-oxazole |
| SMILES | Cc1coc(SCCCCl)n1 |
| InChI | InChI=1S/C7H10ClNOS/c1-6-5-10-7(9-6)11-4-2-3-8/h5H,2-4H2,1H3 |
| InChIKey | NREKXCYHUGJAGY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|