ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate

C9H13NO3S — CID 106920837

IUPACethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate
SMILESCCOC(=O)CCSc1nc(C)co1
InChIInChI=1S/C9H13NO3S/c1-3-12-8(11)4-5-14-9-10-7(2)6-13-9/h6H,3-5H2,1-2H3
InChIKeyCCJAJMJQQNSJLJ-UHFFFAOYSA-N
MW215.27 g/mol
LogP2.03
Rot. Bonds5

About ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate

ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate (PubChem CID 106920837) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate.

Molecular Properties

Compound Nameethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate
PubChem CID106920837
Molecular FormulaC9H13NO3S
Molecular Weight215.27 g/mol
Exact Mass215.06
IUPAC Nameethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate
SMILESCCOC(=O)CCSc1nc(C)co1
InChIInChI=1S/C9H13NO3S/c1-3-12-8(11)4-5-14-9-10-7(2)6-13-9/h6H,3-5H2,1-2H3
InChIKeyCCJAJMJQQNSJLJ-UHFFFAOYSA-N
XLogP2.03
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.27
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The IUPAC name of ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate (CID 106920837) is ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate.
What is the SMILES notation for ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The canonical SMILES for ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate is CCOC(=O)CCSc1nc(C)co1.
What is the InChIKey of ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The InChIKey is CCJAJMJQQNSJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-3-12-8(11)4-5-14-9-10-7(2)6-13-9/h6H,3-5H2,1-2H3.
What are the key properties of ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate has a molecular weight of 215.27 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propanoate is sourced from PubChem (CID 106920837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).