About ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate
ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate (PubChem CID 106920911) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate.
Analyze ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The IUPAC name of ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate (CID 106920911) is ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate.
What is the SMILES notation for ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The canonical SMILES for ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate is CCOC(=O)CCSc1nc(C)c(C)o1.
What is the InChIKey of ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
The InChIKey is QIIZCQXPTLZMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-4-13-9(12)5-6-15-10-11-7(2)8(3)14-10/h4-6H2,1-3H3.
What are the key properties of ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate?
ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate has a molecular weight of 229.30 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanoate is sourced from PubChem (CID 106920911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).